Information card for entry 7241646
| Formula |
C3 H16 B2 N2 |
| Calculated formula |
C3 H16 B2 N2 |
| SMILES |
[NH2]([BH2][N](C)(C)C)[BH3] |
| Title of publication |
Syntheses, formation mechanisms and structures of a series of linear diborazanes |
| Authors of publication |
Li, Huizhen; Wang, Ruirui; Kang, Jiaxin; Li, Shujun; Zhou, Ai-Ju; Han, Dong-xue; Guan, Hong-Yu; Austin, Douglas J.; Yue, Yanfeng |
| Journal of publication |
CrystEngComm |
| Year of publication |
2021 |
| Journal volume |
23 |
| Journal issue |
2 |
| Pages of publication |
404 - 410 |
| a |
13.4684 ± 0.0005 Å |
| b |
13.4684 ± 0.0005 Å |
| c |
8.2997 ± 0.0006 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1505.55 ± 0.13 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
86 |
| Hermann-Mauguin space group symbol |
P 42/n :2 |
| Hall space group symbol |
-P 4bc |
| Residual factor for all reflections |
0.0411 |
| Residual factor for significantly intense reflections |
0.0351 |
| Weighted residual factors for significantly intense reflections |
0.1015 |
| Weighted residual factors for all reflections included in the refinement |
0.1106 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.652 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7241646.html
