Information card for entry 7242251
| Formula |
C14 H12 Br N3 O2 S |
| Calculated formula |
C14 H12 Br N3 O2 S |
| SMILES |
c1c2c(c(ccc2NS(=O)(=O)c2ccc(cc2)C)Br)[nH]n1 |
| Title of publication |
A regioselective C7 bromination and C7 palladium-catalyzed Suzuki–Miyaura cross-coupling arylation of 4-substituted NH-free indazoles |
| Authors of publication |
Boujdi, Khalid; El Brahmi, Nabil; Graton, Jérôme; Dubreuil, Didier; Collet, Sylvain; Mathé-Allainmat, Monique; Akssira, Mohamed; Lebreton, Jacques; El Kazzouli, Saïd |
| Journal of publication |
RSC Advances |
| Year of publication |
2021 |
| Journal volume |
11 |
| Journal issue |
12 |
| Pages of publication |
7107 - 7114 |
| a |
14.3718 ± 0.0004 Å |
| b |
5.0528 ± 0.0002 Å |
| c |
19.9057 ± 0.0006 Å |
| α |
90° |
| β |
92.002 ± 0.002° |
| γ |
90° |
| Cell volume |
1444.63 ± 0.08 Å3 |
| Cell temperature |
150 ± 0.1 K |
| Ambient diffraction temperature |
150 ± 0.1 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.038 |
| Residual factor for significantly intense reflections |
0.035 |
| Weighted residual factors for significantly intense reflections |
0.0887 |
| Weighted residual factors for all reflections included in the refinement |
0.0909 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.093 |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7242251.html