Information card for entry 7242360
| Common name |
pyrazolo[3,4-c]pyrazole |
| Formula |
C19 H18 N4 O2 |
| Calculated formula |
C19 H18 N4 O2 |
| SMILES |
c1(c2c(n(C)n1)n(c1ccc(cc1)OC)nc2)c1ccc(cc1)OC |
| Title of publication |
Access and modulation of substituted 1-methyl-1,6-dihydropyrazolo[3,4-c]pyrazoles |
| Authors of publication |
Ostache, Nicu-Cosmin; Hiebel, Marie-Aude; Fînaru, Adriana-LuminiĊ£a; Allouchi, Hassan; Guillaumet, Gérald; Suzenet, Franck |
| Journal of publication |
RSC Advances |
| Year of publication |
2021 |
| Journal volume |
11 |
| Journal issue |
16 |
| Pages of publication |
9756 - 9765 |
| a |
7.3904 ± 0.0008 Å |
| b |
19.8941 ± 0.0014 Å |
| c |
11.3675 ± 0.0011 Å |
| α |
90° |
| β |
90.409 ± 0.009° |
| γ |
90° |
| Cell volume |
1671.3 ± 0.3 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1309 |
| Residual factor for significantly intense reflections |
0.0603 |
| Weighted residual factors for significantly intense reflections |
0.1233 |
| Weighted residual factors for all reflections included in the refinement |
0.1584 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.974 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7242360.html