Information card for entry 7703773
| Formula |
C24 H25 Co N5 S2 |
| Calculated formula |
C24 H25 Co N5 S2 |
| SMILES |
[Co]12([n]3c(cccc3)C[N]2(Cc2[n]1cccc2)Cc1c(cc(cc1C)C)C)(N=C=S)N=C=S |
| Title of publication |
Influence of ligand field on magnetic anisotropy in a family of pentacoordinate Co<sup>II</sup> complexes. |
| Authors of publication |
Acharya, Joydev; Sarkar, Arup; Kumar, Pawan; Kumar, Vierandra; Flores Gonzalez, Jessica; Cador, Olivier; Pointillart, Fabrice; Rajaraman, Gopalan; Chandrasekhar, Vadapalli |
| Journal of publication |
Dalton transactions (Cambridge, England : 2003) |
| Year of publication |
2020 |
| Journal volume |
49 |
| Journal issue |
15 |
| Pages of publication |
4785 - 4796 |
| a |
8.4712 ± 0.0001 Å |
| b |
9.4205 ± 0.0002 Å |
| c |
15.808 ± 0.0002 Å |
| α |
101.448 ± 0.001° |
| β |
91.172 ± 0.001° |
| γ |
102.322 ± 0.001° |
| Cell volume |
1205.34 ± 0.03 Å3 |
| Cell temperature |
119.97 ± 0.1 K |
| Ambient diffraction temperature |
119.97 ± 0.1 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0381 |
| Residual factor for significantly intense reflections |
0.0329 |
| Weighted residual factors for significantly intense reflections |
0.0826 |
| Weighted residual factors for all reflections included in the refinement |
0.0857 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.072 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7703773.html
