Information card for entry 7713693
| Formula |
C3 H6 N8 O |
| Calculated formula |
C3 H6 N8 O |
| SMILES |
Nc1oc(c2[n-]nnn2)nn1.[NH4+] |
| Title of publication |
Combining the Advantages of 1,3,4-Oxadiazole and Tetrazole Enables High-Energy Insensitive Materials |
| Authors of publication |
Zhang, Chao; Xu, Meiqi; Dong, Wen-Shuai; Lu, Zu-Jia; Zhang, Han; Wu, Xiaowei; Li, Zhimin; Zhang, Jianguo |
| Journal of publication |
Dalton Transactions |
| Year of publication |
2023 |
| a |
8.5376 ± 0.0019 Å |
| b |
7.1964 ± 0.0015 Å |
| c |
11.685 ± 0.004 Å |
| α |
90° |
| β |
105.27 ± 0.03° |
| γ |
90° |
| Cell volume |
692.6 ± 0.3 Å3 |
| Cell temperature |
115.75 ± 0.1 K |
| Ambient diffraction temperature |
115.75 ± 0.1 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.1374 |
| Residual factor for significantly intense reflections |
0.0818 |
| Weighted residual factors for significantly intense reflections |
0.1694 |
| Weighted residual factors for all reflections included in the refinement |
0.2002 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.034 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7713693.html