Information card for entry 1546066
| Formula |
C25 H24 B Cl2 Cu F4 N6 |
| Calculated formula |
C25 H24 B Cl2 Cu F4 N6 |
| SMILES |
[Cu]12([n]3ccccc3C=[N]1c1ccc(N)cc1)[n]1ccccc1C=[N]2c1ccc(N)cc1.[B](F)(F)(F)[F-].ClCCl |
| Title of publication |
New copper (I) complex based initiating systems in redox polymerization and comparison with amine/benzoyl peroxide reference |
| Authors of publication |
Lalevée, Jacques; Dietlin, Céline; Morlet-Savary, Fabrice; Fouassier, Jean Pierre; Gigmes, Didier; Dumur, Frederic; Kermagoret, Anthony; Garra, Patxi; Mousawi, Assi |
| Journal of publication |
Polym. Chem. |
| Year of publication |
2017 |
| a |
11.15632 ± 0.00015 Å |
| b |
11.63305 ± 0.00016 Å |
| c |
22.483 ± 0.0003 Å |
| α |
90° |
| β |
102.758 ± 0.0013° |
| γ |
90° |
| Cell volume |
2845.85 ± 0.07 Å3 |
| Cell temperature |
173.01 ± 0.1 K |
| Ambient diffraction temperature |
173.01 ± 0.1 K |
| Number of distinct elements |
7 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0481 |
| Residual factor for significantly intense reflections |
0.0437 |
| Weighted residual factors for significantly intense reflections |
0.1208 |
| Weighted residual factors for all reflections included in the refinement |
0.1254 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.043 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1546066.html