Information card for entry 1546067
| Formula |
C52 H49 B Cu F4 N3 O2 P2 |
| Calculated formula |
C52 H49 B Cu F4 N3 O2 P2 |
| SMILES |
[Cu]12([P](c3ccccc3)(c3ccccc3)c3ccccc3Oc3ccccc3[P]1(c1ccccc1)c1ccccc1)[n]1ccccc1C=[N]2c1ccc(N)cc1.[B](F)(F)(F)[F-].O(CC)CC |
| Title of publication |
New copper (I) complex based initiating systems in redox polymerization and comparison with amine/benzoyl peroxide reference |
| Authors of publication |
Lalevée, Jacques; Dietlin, Céline; Morlet-Savary, Fabrice; Fouassier, Jean Pierre; Gigmes, Didier; Dumur, Frederic; Kermagoret, Anthony; Garra, Patxi; Mousawi, Assi |
| Journal of publication |
Polym. Chem. |
| Year of publication |
2017 |
| a |
12.3268 ± 0.0003 Å |
| b |
21.2128 ± 0.0005 Å |
| c |
19.3122 ± 0.0005 Å |
| α |
90° |
| β |
104.764 ± 0.003° |
| γ |
90° |
| Cell volume |
4883.1 ± 0.2 Å3 |
| Cell temperature |
293 K |
| Ambient diffraction temperature |
293 K |
| Number of distinct elements |
8 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0797 |
| Residual factor for significantly intense reflections |
0.0574 |
| Weighted residual factors for significantly intense reflections |
0.1496 |
| Weighted residual factors for all reflections included in the refinement |
0.165 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.015 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1546067.html