Information card for entry 1550082
| Chemical name |
Diethyl 4-(4-chloro-2-propyl-1<i>H</i>-imidazol-5-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate monohydrate |
| Formula |
C19 H28 Cl N3 O5 |
| Calculated formula |
C19 H28 Cl N3 O5 |
| SMILES |
Clc1nc([nH]c1C1C(=C(NC(=C1C(=O)OCC)C)C)C(=O)OCC)CCC.O |
| Title of publication |
Diethyl 4-(4-chloro-2-propyl-1<i>H</i>-imidazol-5-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate monohydrate |
| Authors of publication |
Rasheeda, Kedila; Samshuddin, Seranthimata; Swathi, Phadke N.; Alva, Vijaya D. P.; Mague, Joel T.; Ramli, Youssef |
| Journal of publication |
IUCrData |
| Year of publication |
2018 |
| Journal volume |
3 |
| Journal issue |
10 |
| Pages of publication |
x181470 |
| a |
8.5308 ± 0.0011 Å |
| b |
8.5308 ± 0.0011 Å |
| c |
31.893 ± 0.004 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2321 ± 0.5 Å3 |
| Cell temperature |
200 ± 2 K |
| Ambient diffraction temperature |
200 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
78 |
| Hermann-Mauguin space group symbol |
P 43 |
| Hall space group symbol |
P 4cw |
| Residual factor for all reflections |
0.0761 |
| Residual factor for significantly intense reflections |
0.0646 |
| Weighted residual factors for significantly intense reflections |
0.1727 |
| Weighted residual factors for all reflections included in the refinement |
0.182 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.064 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1550082.html