Information card for entry 1550083
| Chemical name |
(+/-)1,9-Bis(4-anisyl)tricyclo[3.3.1.0^2,8^]nona-3,6-dien-9-ol |
| Formula |
C23 H22 O3 |
| Calculated formula |
C23 H22 O3 |
| SMILES |
O[C@@]1(C2(c3ccc(OC)cc3)[C@@H]3C=CC1C=C[C@H]23)c1ccc(OC)cc1.O[C@]1(C2(c3ccc(OC)cc3)[C@H]3C=CC1C=C[C@@H]23)c1ccc(OC)cc1 |
| Title of publication |
Shape-selective crystallisation of fluxional carbon cages. |
| Authors of publication |
Bismillah, Aisha N.; Sturala, Jiri; Chapin, Brette M.; Yufit, Dmitry S.; Hodgkinson, Paul; McGonigal, Paul R. |
| Journal of publication |
Chemical science |
| Year of publication |
2018 |
| Journal volume |
9 |
| Journal issue |
46 |
| Pages of publication |
8631 - 8636 |
| a |
13.7826 ± 0.0005 Å |
| b |
9.2243 ± 0.0002 Å |
| c |
15.0346 ± 0.0005 Å |
| α |
90° |
| β |
111.733 ± 0.004° |
| γ |
90° |
| Cell volume |
1775.56 ± 0.11 Å3 |
| Cell temperature |
270 ± 2 K |
| Ambient diffraction temperature |
270 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0672 |
| Residual factor for significantly intense reflections |
0.0467 |
| Weighted residual factors for significantly intense reflections |
0.1117 |
| Weighted residual factors for all reflections included in the refinement |
0.1245 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.046 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1550083.html