Information card for entry 2003503
| Chemical name |
Ethyl 3-(4-chlorophényl)-3a-méthyl- 5-phényl-3,3a,4,11-tétrahydro-3H-[1,2,4] triazolo [4,3-a] [1,5] benzodiazépine |
| Formula |
C26 H23 Cl N4 O2 |
| Calculated formula |
C26 H23 Cl N4 O2 |
| SMILES |
CCOC(=O)C1=NN(C2(N1c1ccccc1N=C(C2)c1ccccc1)C)c1ccc(cc1)Cl |
| Title of publication |
Ethyl 3-(4-Chlorophényl)-3a-méthyl-5-phényl-3,3a,4,11-tétrahydro-3<i>H</i>-[1,2,4]triazolo[4,3-<i>a</i>][1,5]benzodiazépine-1-carboxylate, C~26~H~23~ClN~4~O~2~ |
| Authors of publication |
Chiaroni, A.; Riche, C.; Baouid, A.; Benharref, A.; Hasnaoui, A.; Lavergne, J.-P. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1995 |
| Journal volume |
51 |
| Journal issue |
5 |
| Pages of publication |
961 - 963 |
| a |
10.207 ± 0.008 Å |
| b |
26.978 ± 0.012 Å |
| c |
8.744 ± 0.006 Å |
| α |
90° |
| β |
106.96 ± 0.03° |
| γ |
90° |
| Cell volume |
2303 ± 3 Å3 |
| Cell temperature |
293 K |
| Ambient diffraction temperature |
293 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for significantly intense reflections |
0.06 |
| Weighted residual factors for significantly intense reflections |
0.059 |
| Goodness-of-fit parameter for significantly intense reflections |
1.99 |
| Diffraction radiation wavelength |
1.5418 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2003503.html