Information card for entry 2014118
| Common name |
2-(6-bromo-pyridin-2-yl)-6-methyl-[1,3,6,2]dioxazaborocane |
| Chemical name |
6a-(6-bromopyridin-2-yl)-3a-methyl-2,3,4,5-tetrahydro1,6-dioxa-3a-aza-6a- borapentalene |
| Formula |
C10 H14 B Br N2 O2 |
| Calculated formula |
C10 H14 B Br N2 O2 |
| SMILES |
Brc1nc(ccc1)[B]12OCC[N]2(CCO1)C |
| Title of publication |
2-(6-Bromopyridin-2-yl)-6-methyl-[1,3,6,2]dioxazaborocane, a new stable (pyridin-2-yl)boronic acid derivative |
| Authors of publication |
Sopková-de Oliveira Santos, Jana; Bouillon, Alexandre; Lancelot, Jean-Charles; Rault, Sylvain |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2004 |
| Journal volume |
60 |
| Journal issue |
8 |
| Pages of publication |
o582 - o584 |
| a |
10.7716 ± 0.0012 Å |
| b |
7.0104 ± 0.0007 Å |
| c |
15.5546 ± 0.0014 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1174.6 ± 0.2 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
29 |
| Hermann-Mauguin space group symbol |
P c a 21 |
| Hall space group symbol |
P 2c -2ac |
| Residual factor for all reflections |
0.0706 |
| Residual factor for significantly intense reflections |
0.0492 |
| Weighted residual factors for significantly intense reflections |
0.131 |
| Weighted residual factors for all reflections included in the refinement |
0.1442 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.063 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2014118.html