Information card for entry 2014119
| Common name |
bis(ethyl-acetoacetate)ethylenediimine |
| Chemical name |
Diethyl 3,8-dimethyl-4,7-diazadec-2,8-dienedioate |
| Formula |
C14 H24 N2 O4 |
| Calculated formula |
C14 H24 N2 O4 |
| SMILES |
CCOC(=O)/C=C(\NCCN/C(=C\C(=O)OCC)C)C |
| Title of publication |
Diethyl 3,8-dimethyl-4,7-diazadeca-2,8-dienedioate |
| Authors of publication |
Jin, Zhi-Min; Li, Li; Li, Mei-Chao; Hu, Mao-Lin; Shen, Liang |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2004 |
| Journal volume |
60 |
| Journal issue |
9 |
| Pages of publication |
o642 - o643 |
| a |
11.734 ± 0.003 Å |
| b |
10.566 ± 0.002 Å |
| c |
13.418 ± 0.003 Å |
| α |
90° |
| β |
111.44 ± 0.01° |
| γ |
90° |
| Cell volume |
1548.5 ± 0.6 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0779 |
| Residual factor for significantly intense reflections |
0.047 |
| Weighted residual factors for significantly intense reflections |
0.1037 |
| Weighted residual factors for all reflections included in the refinement |
0.1123 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.914 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2014119.html