Information card for entry 2016932
| Common name |
6,12-dibromodibenzo[<i>d</i>,<i>i</i>]-1,2,3,6,7,8-hexahydro-1,3-dioxecin |
| Chemical name |
8,16-dibromo-2,4-dioxatricyclo[12.4.0.0^5,10^]octadeca-5,7,9,14,16,18-hexaene |
| Formula |
C16 H14 Br2 O2 |
| Calculated formula |
C16 H14 Br2 O2 |
| SMILES |
Brc1cc2CCCc3c(ccc(Br)c3)OCOc2cc1 |
| Title of publication |
Two similar dibenzo cyclic ethers with dissimilar conformations |
| Authors of publication |
Burns, Dennis H.; Meece, F. Alex; Moore, Curtis E.; Eichhorn, David M. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
1 |
| Pages of publication |
o27 - o30 |
| a |
21.3204 ± 0.0005 Å |
| b |
8.8456 ± 0.0002 Å |
| c |
7.8155 ± 0.0002 Å |
| α |
90° |
| β |
97.969 ± 0.001° |
| γ |
90° |
| Cell volume |
1459.71 ± 0.06 Å3 |
| Cell temperature |
150 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0364 |
| Residual factor for significantly intense reflections |
0.0262 |
| Weighted residual factors for significantly intense reflections |
0.0528 |
| Weighted residual factors for all reflections included in the refinement |
0.0563 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.077 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2016932.html