Information card for entry 2016933
| Common name |
2,12-dibromodibenzo[<i>f</i>,<i>k</i>]-1,5-dioxa-1,2,3,4,5,8,9,10- octahydrocyclododecene |
| Chemical name |
7,19-dibromo-11,15-dioxatricyclo[14.4.0.0^5,10^]icosaa-5,7,9,16,18,20-hexaene |
| Formula |
C18 H18 Br2 O2 |
| Calculated formula |
C18 H18 Br2 O2 |
| SMILES |
Brc1ccc2c(c1)CCCc1c(ccc(Br)c1)OCCCO2 |
| Title of publication |
Two similar dibenzo cyclic ethers with dissimilar conformations |
| Authors of publication |
Burns, Dennis H.; Meece, F. Alex; Moore, Curtis E.; Eichhorn, David M. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
1 |
| Pages of publication |
o27 - o30 |
| a |
13.7971 ± 0.0005 Å |
| b |
8.5744 ± 0.0003 Å |
| c |
28.1906 ± 0.001 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
3335 ± 0.2 Å3 |
| Cell temperature |
150 ± 2 K |
| Ambient diffraction temperature |
150 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.0894 |
| Residual factor for significantly intense reflections |
0.0396 |
| Weighted residual factors for significantly intense reflections |
0.08 |
| Weighted residual factors for all reflections included in the refinement |
0.0997 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.034 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2016933.html