Information card for entry 2203069
| Chemical name |
Bis(μ-1,2,4-triazole-κ^2^N^1^:N^2^)bis[aqua(oxalato-κ^2^O,O')copper(II)] |
| Formula |
C8 H14 Cu2 N6 O12 |
| Calculated formula |
C8 H14 Cu2 N6 O12 |
| SMILES |
C1(=O)O[Cu]2([n]3c[nH]c[n]3[Cu]3([n]4c[nH]c[n]24)(OC(=O)C(=O)O3)([OH2])[OH2])(OC1=O)([OH2])[OH2] |
| Title of publication |
Bis(μ-1,2,4-triazole-κ^2^<i>N</i>^1^:<i>N</i>^2^)bis[diaqua(oxalato-κ^2^<i>O,O</i>')copper(II)] |
| Authors of publication |
Castillo, Oscar; García-Couceiro, Urko; Luque, Antonio; García-Terán, Juan P.; Román, Pascual |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2004 |
| Journal volume |
60 |
| Journal issue |
1 |
| Pages of publication |
m9 - m11 |
| a |
16.596 ± 0.001 Å |
| b |
16.596 ± 0.001 Å |
| c |
11.996 ± 0.002 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
3304 ± 0.6 Å3 |
| Cell temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
142 |
| Hermann-Mauguin space group symbol |
I 41/a c d :2 |
| Hall space group symbol |
-I 4bd 2c |
| Residual factor for all reflections |
0.1029 |
| Residual factor for significantly intense reflections |
0.0408 |
| Weighted residual factors for significantly intense reflections |
0.0993 |
| Weighted residual factors for all reflections included in the refinement |
0.1156 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.977 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2203069.html