Information card for entry 2205730
| Chemical name |
Naphthalene-1,4,5,8-tetracarboxylic 1,8-anhydride |
| Formula |
C14 H6 O7 |
| Calculated formula |
C14 H6 O7 |
| SMILES |
O=C1c2ccc(c3c(ccc(c23)C(=O)O1)C(=O)O)C(=O)O |
| Title of publication |
Naphthalene-1,4,5,8-tetracarboxylic 1,8-anhydride |
| Authors of publication |
Xu, Yan-Qing; Yuan, Da-Qiang; Zhou, You-Fu; Wu, Ming-Yan; Hong, Mao-Chun |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
5 |
| Pages of publication |
o1294 - o1296 |
| a |
7.6811 ± 0.0015 Å |
| b |
9.754 ± 0.002 Å |
| c |
14.357 ± 0.003 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1075.6 ± 0.4 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0821 |
| Residual factor for significantly intense reflections |
0.0634 |
| Weighted residual factors for significantly intense reflections |
0.128 |
| Weighted residual factors for all reflections included in the refinement |
0.1385 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.093 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2205730.html