Information card for entry 2205731
| Formula |
C23 H23 F O8 |
| Calculated formula |
C23 H23 F O8 |
| SMILES |
F[C@H]1[C@@H]2[C@@H]([C@@H](c3c1cc1OCOc1c3)c1cc(OC)c(O)c(O)c1)C(=O)OC2.O=C(C)C |
| Title of publication |
(5<i>R</i>,5a<i>R</i>,8a<i>R</i>,9<i>S</i>)-5-(3,4-dihydroxy-5-methoxyphenyl)-9-fluoro-5,8,8a,9-tetrahydrofuro[3',4':6,7]naphtho[2,3-<i>d</i>]-1,3-dioxol-6(5a<i>H</i>)-one acetone solvate |
| Authors of publication |
Zhou, Feng-Yan; Jian, Shan-Zhong; He, Xue-Ying; Wang, Yan-Guang |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
5 |
| Pages of publication |
o1374 - o1376 |
| a |
19.1786 ± 0.0009 Å |
| b |
7.7058 ± 0.0003 Å |
| c |
14.0757 ± 0.0007 Å |
| α |
90° |
| β |
92.373 ± 0.002° |
| γ |
90° |
| Cell volume |
2078.41 ± 0.16 Å3 |
| Cell temperature |
296.1 K |
| Number of distinct elements |
4 |
| Space group number |
5 |
| Hermann-Mauguin space group symbol |
C 1 2 1 |
| Hall space group symbol |
C 2y |
| Residual factor for significantly intense reflections |
0.047 |
| Weighted residual factors for all reflections included in the refinement |
0.132 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.007 |
| Diffraction radiation wavelength |
0.7107 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2205731.html