Information card for entry 2213288
| Chemical name |
5,6,11,12-Tetrahydro-5,11-bis(bromoacetyl)- 5,12[1',2']:6,11[1'',2'']dibenzenodibenzo[a,e]cyclooctene |
| Formula |
C32 H22 Br2 O2 |
| Calculated formula |
C32 H22 Br2 O2 |
| SMILES |
BrCC(=O)C12c3ccccc3C(c3c1cccc3)C1(c3c(C2c2ccccc12)cccc3)C(=O)CBr |
| Title of publication |
9-(Bromoacetyl)anthracene dimer |
| Authors of publication |
Kubo, Kanji; Matsumoto, Taisuke; Ideta, Keiko; Watanabe, Kenichiro; Sakurai, Tadamitsu |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
5 |
| Pages of publication |
o2609 - o2610 |
| a |
7.9044 ± 0.0018 Å |
| b |
9.1861 ± 0.0017 Å |
| c |
9.4138 ± 0.0017 Å |
| α |
66.648 ± 0.009° |
| β |
75.696 ± 0.01° |
| γ |
83.656 ± 0.011° |
| Cell volume |
608 ± 0.2 Å3 |
| Cell temperature |
153.1 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for significantly intense reflections |
0.036 |
| Weighted residual factors for all reflections included in the refinement |
0.074 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.052 |
| Diffraction radiation wavelength |
0.7107 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2213288.html