Information card for entry 2213289
| Chemical name |
3-(5-Methylsulfanyl-1,3,4-thiadiazol-2-yldiazenyl)-1,2-methyl-1H-indole |
| Formula |
C13 H13 N5 S2 |
| Calculated formula |
C13 H13 N5 S2 |
| SMILES |
s1c(N=Nc2c3c(n(c2C)C)cccc3)nnc1SC |
| Title of publication |
1,2-Dimethyl-3-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)diazenyl]-1<i>H</i>-indole |
| Authors of publication |
Hökelek, Tuncer; Seferoğlu, Zeynel; Şahin, Ertan; Ertan, Nermin |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
5 |
| Pages of publication |
o2263 - o2264 |
| a |
7.2739 ± 0.0002 Å |
| b |
13.4818 ± 0.0002 Å |
| c |
14.7373 ± 0.0004 Å |
| α |
78.488 ± 0.004° |
| β |
87.707 ± 0.005° |
| γ |
85.551 ± 0.005° |
| Cell volume |
1411.43 ± 0.06 Å3 |
| Cell temperature |
294 ± 2 K |
| Ambient diffraction temperature |
294 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.132 |
| Residual factor for significantly intense reflections |
0.074 |
| Weighted residual factors for significantly intense reflections |
0.168 |
| Weighted residual factors for all reflections included in the refinement |
0.198 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.04 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2213289.html