Information card for entry 2214783
| Chemical name |
Aquabis(1,10-phenanthroline-κ^2^<i>N</i>,<i>N'</i>)[2,4,6-\ tris(4-sulfonatophenylamino)-1,3,5-triazin-1-ium-κ<i>O</i>]nickel(II) dihydrate |
| Formula |
C45 H38 N10 Ni O12 S3 |
| Calculated formula |
C45 H38 N10 Ni O12 S3 |
| SMILES |
[Ni]12(OS(=O)(=O)c3ccc(Nc4nc(nc([nH+]4)Nc4ccc(S(=O)(=O)[O-])cc4)Nc4ccc(S(=O)(=O)[O-])cc4)cc3)([OH2])([n]3c4c5[n]1cccc5ccc4ccc3)[n]1c3c4[n]2cccc4ccc3ccc1.O.O |
| Title of publication |
Aquabis(1,10-phenanthroline-κ^2^<i>N</i>,<i>N</i>')[2,4,6-tris(4-sulfonatophenylamino)-1,3,5-triazin-1-ium-κ<i>O</i>]nickel(II) dihydrate |
| Authors of publication |
Yun-Fang Yu; Yong-Qin Wei; Ke-Chen Wu |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
8 |
| Pages of publication |
m2119 - m2119 |
| a |
8.256 ± 0.002 Å |
| b |
11.684 ± 0.003 Å |
| c |
24.086 ± 0.007 Å |
| α |
76.134 ± 0.007° |
| β |
84.875 ± 0.01° |
| γ |
75.718 ± 0.006° |
| Cell volume |
2184.9 ± 1 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0657 |
| Residual factor for significantly intense reflections |
0.0466 |
| Weighted residual factors for significantly intense reflections |
0.0976 |
| Weighted residual factors for all reflections included in the refinement |
0.1079 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.053 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2214783.html