Information card for entry 2214784
| Chemical name |
2,3-<i>C</i>-Dimethyl-3,4-<i>O</i>-isopropylidene-D-allono-1,5-lactone |
| Formula |
C11 H18 O6 |
| Calculated formula |
C11 H18 O6 |
| SMILES |
[C@@]12([C@](C(=O)O[C@@H]([C@H]1OC(O2)(C)C)CO)(O)C)C |
| Title of publication |
2,3-<i>C</i>-Dimethyl-3,4-<i>O</i>-isopropylidene-<small>D</small>-allono-1,5-lactone |
| Authors of publication |
Curran, Louise A.; Jenkinson, Sarah F.; Jones, Nigel A.; Watkin, David J.; Fleet, George W. J. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
8 |
| Pages of publication |
o3387 - o3387 |
| a |
6.9089 ± 0.0002 Å |
| b |
12.2072 ± 0.0005 Å |
| c |
14.2507 ± 0.0005 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1201.88 ± 0.07 Å3 |
| Cell temperature |
150 K |
| Ambient diffraction temperature |
150 K |
| Number of distinct elements |
3 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0432 |
| Residual factor for significantly intense reflections |
0.0321 |
| Weighted residual factors for all reflections |
0.0726 |
| Weighted residual factors for significantly intense reflections |
0.0683 |
| Weighted residual factors for all reflections included in the refinement |
0.0726 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.9228 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2214784.html