Information card for entry 2214785
| Chemical name |
2,6-Anhydro-1-deoxy-3,4-<i>O</i>-isopropylidene-3-<i>C</i>-methyl-β-D- ribo-hex-2-ulofuranose |
| Formula |
C10 H16 O4 |
| Calculated formula |
C10 H16 O4 |
| SMILES |
[C@@]12([C@]3(O[C@@H]([C@H]1OC(O2)(C)C)CO3)C)C |
| Title of publication |
2,6-Anhydro-1-deoxy-3,4-<i>O</i>-isopropylidene-3-<i>C</i>-methyl-β-<small>D</small>-<i>ribo</i>-hex-2-ulofuranose |
| Authors of publication |
Curran, Louise A.; Jenkinson, Sarah F.; Jones, Nigel A.; Watkin, David J.; Fleet, George W. J. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
8 |
| Pages of publication |
o3388 - o3388 |
| a |
6.6307 ± 0.0002 Å |
| b |
11.1029 ± 0.0004 Å |
| c |
14.1409 ± 0.0005 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1041.05 ± 0.06 Å3 |
| Cell temperature |
150 K |
| Ambient diffraction temperature |
150 K |
| Number of distinct elements |
3 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0411 |
| Residual factor for significantly intense reflections |
0.0309 |
| Weighted residual factors for all reflections |
0.0736 |
| Weighted residual factors for significantly intense reflections |
0.0697 |
| Weighted residual factors for all reflections included in the refinement |
0.0736 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.9261 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2214785.html