Information card for entry 2217739
| Chemical name |
{2,2'-[1,1'-(3-Azapentane-1,5- diyldinitrilo)diethylidyne]diphenolato}(piperidine)cobalt(III) tetraphenylborate |
| Formula |
C49 H54 B Co N4 O2 |
| Calculated formula |
C49 H54 B Co N4 O2 |
| SMILES |
[Co]1234([NH](CC[N]1=C(c1c(O4)cccc1)C)CC[N]2=C(c1c(O3)cccc1)C)[NH]1CCCCC1.[B-](c1ccccc1)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| Title of publication |
{2,2'-[1,1'-(3-Azapentane-1,5-diyldinitrilo)diethylidyne]diphenolato}(piperidine)cobalt(III) tetraphenylborate |
| Authors of publication |
Meghdadi, Soraia; Schenk, Kurt J.; Amirnasr, Mehdi; Fadaee, Farzaneh |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
3 |
| Pages of publication |
m479 - m480 |
| a |
11.1188 ± 0.0007 Å |
| b |
16.8783 ± 0.001 Å |
| c |
23.3398 ± 0.0013 Å |
| α |
91.222 ± 0.005° |
| β |
96.054 ± 0.005° |
| γ |
100.914 ± 0.005° |
| Cell volume |
4273.1 ± 0.4 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0946 |
| Residual factor for significantly intense reflections |
0.0429 |
| Weighted residual factors for significantly intense reflections |
0.1009 |
| Weighted residual factors for all reflections included in the refinement |
0.1191 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.929 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2217739.html