Information card for entry 2217740
| Common name |
2,2'-{1,2-phenylenebis(nitrilomethylidyne)}bis(4,6-di-<i>tert</i>-butylphenol) acetone solvate |
| Chemical name |
4,4',6,6'-Tetra-<i>tert</i>-butyl-2,2'-[1,2- phenylenebis(nitrilomethylidyne)]diphenol acetone solvate |
| Formula |
C39 H54 N2 O3 |
| Calculated formula |
C39 H54 N2 O3 |
| SMILES |
Oc1c(cc(cc1/C=N/c1ccccc1/N=C/c1cc(cc(c1O)C(C)(C)C)C(C)(C)C)C(C)(C)C)C(C)(C)C.O=C(C)C |
| Title of publication |
4,4',6,6'-Tetra-<i>tert</i>-butyl-2,2'-[1,2-phenylenebis(nitrilomethylidyne)]diphenol acetone solvate |
| Authors of publication |
Eltayeb, Naser Eltaher; Teoh, Siang Guan; Chantrapromma, Suchada; Fun, Hoong-Kun; Adnan, Rohana |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
3 |
| Pages of publication |
o576 - o577 |
| a |
10.0008 ± 0.0002 Å |
| b |
12.002 ± 0.0003 Å |
| c |
17.0366 ± 0.0004 Å |
| α |
82.068 ± 0.001° |
| β |
86.32 ± 0.001° |
| γ |
65.764 ± 0.001° |
| Cell volume |
1846.76 ± 0.07 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0857 |
| Residual factor for significantly intense reflections |
0.0599 |
| Weighted residual factors for significantly intense reflections |
0.1608 |
| Weighted residual factors for all reflections included in the refinement |
0.1828 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.037 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2217740.html