Information card for entry 2221034
| Chemical name |
3-[1-(4-Isobutylphenyl)ethyl]-1<i>H</i>-1,2,4-triazole-5(4<i>H</i>)-thione |
| Formula |
C14 H19 N3 S |
| Calculated formula |
C14 H19 N3 S |
| SMILES |
S=C1NC(=NN1)C(c1ccc(cc1)CC(C)C)C |
| Title of publication |
3-[1-(4-Isobutylphenyl)ethyl]-1<i>H</i>-1,2,4-triazole-5(4<i>H</i>)-thione |
| Authors of publication |
Fun, Hoong-Kun; Kia, Reza; Samuel, Robinson Jebas; Sujith, K. V; Kalluraya, B. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
3 |
| Pages of publication |
o618 |
| a |
12.0905 ± 0.0002 Å |
| b |
8.4408 ± 0.0001 Å |
| c |
14.3189 ± 0.0002 Å |
| α |
90° |
| β |
98.365 ± 0.001° |
| γ |
90° |
| Cell volume |
1445.75 ± 0.04 Å3 |
| Cell temperature |
100 ± 0.1 K |
| Ambient diffraction temperature |
100 ± 0.1 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0468 |
| Residual factor for significantly intense reflections |
0.038 |
| Weighted residual factors for significantly intense reflections |
0.1029 |
| Weighted residual factors for all reflections included in the refinement |
0.1084 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.027 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2221034.html