Information card for entry 2221035
| Chemical name |
Chlorido{2,2'-[propane-1,3-diylbis(nitrilomethylidyne)]diphenolato- κ^4^<i>O</i>,<i>N</i>,<i>N</i>',<i>O</i>'}manganese(III) |
| Formula |
C17 H16 Cl Mn N2 O2 |
| Calculated formula |
C17 H16 Cl Mn N2 O2 |
| SMILES |
c12c(cccc1)C=[N]1CCC[N]3=Cc4ccccc4O[Mn]13(Cl)O2 |
| Title of publication |
Chlorido{2,2'-[propane-1,3-diylbis(nitrilomethylidyne)]diphenolato-κ^4^<i>O</i>,<i>N</i>,<i>N</i>',<i>O</i>'}manganese(III) |
| Authors of publication |
Li, Ming-Jie; Yan, Peng-Fei; Li, Guang-Ming; Li, Hong-Feng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
3 |
| Pages of publication |
m306 |
| a |
10.428 ± 0.003 Å |
| b |
12.067 ± 0.004 Å |
| c |
12.53 ± 0.005 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1576.7 ± 0.9 Å3 |
| Cell temperature |
291 ± 2 K |
| Ambient diffraction temperature |
291 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
29 |
| Hermann-Mauguin space group symbol |
P c a 21 |
| Hall space group symbol |
P 2c -2ac |
| Residual factor for all reflections |
0.0376 |
| Residual factor for significantly intense reflections |
0.035 |
| Weighted residual factors for significantly intense reflections |
0.0923 |
| Weighted residual factors for all reflections included in the refinement |
0.0944 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.05 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2221035.html