Information card for entry 2221245
| Chemical name |
6,6'-diethoxy-2,2'-[propane-1,2-diylbis(nitrilomethylidyne)]diphenol |
| Formula |
C21 H26 N2 O4 |
| Calculated formula |
C21 H26 N2 O4 |
| SMILES |
Oc1c(OCC)cccc1/C=N/C(C/N=C/c1cccc(OCC)c1O)C |
| Title of publication |
A second tricilinc polymorph of 6,6'-diethoxy-2,2'-[propane-1,2-diylbis(nitrilomethylidyne)]diphenol |
| Authors of publication |
Fun, Hoong-Kun; Kia, Reza; Kargar, Hadi; Jamshidvand, Arezoo |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
4 |
| Pages of publication |
o722 - o723 |
| a |
8.9729 ± 0.0002 Å |
| b |
10.7008 ± 0.0004 Å |
| c |
11.3633 ± 0.0002 Å |
| α |
107.432 ± 0.001° |
| β |
108.487 ± 0.001° |
| γ |
95.979 ± 0.001° |
| Cell volume |
963.03 ± 0.05 Å3 |
| Cell temperature |
100 K |
| Ambient diffraction temperature |
100 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0522 |
| Residual factor for significantly intense reflections |
0.0447 |
| Weighted residual factors for significantly intense reflections |
0.1249 |
| Weighted residual factors for all reflections included in the refinement |
0.1357 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.045 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2221245.html