Information card for entry 2221246
| Chemical name |
<i>N</i>,<i>N</i>'-Bis(4-bromobenzylidene)-2,2-dimethylpropane-1,3-diamine |
| Formula |
C19 H20 Br2 N2 |
| Calculated formula |
C19 H20 Br2 N2 |
| SMILES |
Brc1ccc(cc1)/C=N/CC(C/N=C/c1ccc(Br)cc1)(C)C |
| Title of publication |
<i>N</i>,<i>N</i>'-Bis(4-bromobenzylidene)-2,2-dimethylpropane-1,3-diamine |
| Authors of publication |
Kia, Reza; Fun, Hoong-Kun; Kargar, Hadi |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
4 |
| Pages of publication |
o747 |
| a |
5.6687 ± 0.0001 Å |
| b |
7.7919 ± 0.0002 Å |
| c |
41.5932 ± 0.0009 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1837.17 ± 0.07 Å3 |
| Cell temperature |
100 K |
| Ambient diffraction temperature |
100 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0533 |
| Residual factor for significantly intense reflections |
0.0365 |
| Weighted residual factors for significantly intense reflections |
0.0743 |
| Weighted residual factors for all reflections included in the refinement |
0.0785 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.026 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2221246.html