Information card for entry 2223643
| Chemical name |
<i>c</i>-3,<i>t</i>-3-Dimethyl-<i>r</i>-2,<i>c</i>-7-diphenyl-1,4-diazepan-5-one |
| Formula |
C19 H22 N2 O |
| Calculated formula |
C19 H22 N2 O |
| SMILES |
O=C1NC([C@@H](N[C@@H](C1)c1ccccc1)c1ccccc1)(C)C.O=C1NC([C@H](N[C@H](C1)c1ccccc1)c1ccccc1)(C)C |
| Title of publication |
<i>c</i>-3,<i>t</i>-3-Dimethyl-<i>r</i>-2,<i>c</i>-7-diphenyl-1,4-diazepan-5-one |
| Authors of publication |
Ravichandran, K.; Ramesh, P.; Sethuvasan, S.; Ponnuswamy, S.; Ponnuswamy, M. N. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
11 |
| Pages of publication |
o2884 |
| a |
6.7354 ± 0.0004 Å |
| b |
10.6867 ± 0.0006 Å |
| c |
11.4186 ± 0.0007 Å |
| α |
82.191 ± 0.003° |
| β |
88.218 ± 0.004° |
| γ |
80.317 ± 0.003° |
| Cell volume |
802.65 ± 0.08 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0736 |
| Residual factor for significantly intense reflections |
0.0606 |
| Weighted residual factors for significantly intense reflections |
0.1593 |
| Weighted residual factors for all reflections included in the refinement |
0.167 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.079 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2223643.html