Information card for entry 2224494
| Chemical name |
1-Ethyl-4-hydroxy-9-azatricyclo[7.4.1.0^2,7^]tetradeca-2,4,6-trien-8-one |
| Formula |
C15 H19 N O2 |
| Calculated formula |
C15 H19 N O2 |
| SMILES |
N12C(=O)c3ccc(O)cc3[C@](C1)(CCCC2)CC |
| Title of publication |
1-Ethyl-4-hydroxy-9-azatricyclo[7.4.1.0^2,7^]tetradeca-2,4,6-trien-8-one |
| Authors of publication |
Zheng, Wei; Xie, Qiong; Li, Fang; Qiu, Zhui-Bai |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
12 |
| Pages of publication |
o3008 |
| a |
8.298 ± 0.001 Å |
| b |
9.9817 ± 0.0012 Å |
| c |
14.7324 ± 0.0018 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1220.3 ± 0.3 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0409 |
| Residual factor for significantly intense reflections |
0.0377 |
| Weighted residual factors for significantly intense reflections |
0.0896 |
| Weighted residual factors for all reflections included in the refinement |
0.0912 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.055 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2224494.html