Information card for entry 2224495
| Chemical name |
4,4'-(Ethene-1,2-diyl)dipyridinium bis[4-(2-carboxybenzoyl)benzoate]] |
| Formula |
C42 H30 N2 O10 |
| Calculated formula |
C42 H30 N2 O10 |
| SMILES |
c1cc(/C=C/c2cc[nH+]cc2)cc[nH+]1.C(=O)(c1ccc(cc1)C(=O)c1ccccc1C(=O)O)[O-].C(=O)(c1ccc(cc1)C(=O)c1ccccc1C(=O)O)[O-] |
| Title of publication |
4,4'-(Ethene-1,2-diyl)dipyridinium bis[4-(2-carboxybenzoyl)benzoate] |
| Authors of publication |
Li, Cai; Li, Dong-Sheng; Zhao, Jun; Zheng, Xue-Gang; Ke, Xi-Jun |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
12 |
| Pages of publication |
o3219 |
| a |
7.1335 ± 0.0013 Å |
| b |
9.4558 ± 0.0017 Å |
| c |
13.206 ± 0.002 Å |
| α |
81.641 ± 0.002° |
| β |
79.986 ± 0.002° |
| γ |
71.26 ± 0.002° |
| Cell volume |
826.9 ± 0.2 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0648 |
| Residual factor for significantly intense reflections |
0.0429 |
| Weighted residual factors for significantly intense reflections |
0.1005 |
| Weighted residual factors for all reflections included in the refinement |
0.1151 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.009 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2224495.html