Information card for entry 2229228
| Chemical name |
1-[2-(4-Nitrophenyl)-5-(5-phenyl-1,2-oxazol-3-yl)-1,2,3,4-tetrahydroquinolin- 4-yl]pyrrolidin-2-one |
| Formula |
C28 H24 N4 O4 |
| Calculated formula |
C28 H24 N4 O4 |
| SMILES |
O=N(=O)c1ccc(cc1)[C@@H]1Nc2c([C@@H](N3CCCC3=O)C1)c(ccc2)c1noc(c1)c1ccccc1 |
| Title of publication |
1-[2-(4-Nitrophenyl)-5-(5-phenyl-1,2-oxazol-3-yl)-1,2,3,4-tetrahydroquinolin-4-yl]pyrrolidin-2-one |
| Authors of publication |
Gutierrez, Margarita; Astudillo, Luis; Quesada, Luisa; Brito, Iván; López-Rodríguez, Matías |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
2 |
| Pages of publication |
o308 - o309 |
| a |
20.753 ± 0.003 Å |
| b |
20.753 ± 0.003 Å |
| c |
10.446 ± 0.002 Å |
| α |
90° |
| β |
90° |
| γ |
120° |
| Cell volume |
3896.2 ± 1.1 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
169 |
| Hermann-Mauguin space group symbol |
P 61 |
| Hall space group symbol |
P 61 |
| Residual factor for all reflections |
0.0902 |
| Residual factor for significantly intense reflections |
0.0751 |
| Weighted residual factors for significantly intense reflections |
0.1554 |
| Weighted residual factors for all reflections included in the refinement |
0.1618 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.215 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2229228.html