Information card for entry 2229229
| Chemical name |
6,9-Dimethoxy-3,4-dihydro-1<i>H</i>-1,4-oxazino[4,3-<i>a</i>]indol-1-one |
| Formula |
C13 H13 N O4 |
| Calculated formula |
C13 H13 N O4 |
| SMILES |
n12CCOC(=O)c1cc1c(ccc(c21)OC)OC |
| Title of publication |
6,9-Dimethoxy-3,4-dihydro-1<i>H</i>-1,4-oxazino[4,3-<i>a</i>]indol-1-one |
| Authors of publication |
Salas, Cristian O.; Tapia, Ricardo A.; Prieto, Yolanda |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
2 |
| Pages of publication |
o318 |
| a |
8.414 ± 0.002 Å |
| b |
6.9722 ± 0.0019 Å |
| c |
19.331 ± 0.005 Å |
| α |
90° |
| β |
101.276 ± 0.004° |
| γ |
90° |
| Cell volume |
1112.1 ± 0.5 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0475 |
| Residual factor for significantly intense reflections |
0.0383 |
| Weighted residual factors for significantly intense reflections |
0.0954 |
| Weighted residual factors for all reflections included in the refinement |
0.1015 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.06 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2229229.html