Information card for entry 2231176
| Chemical name |
2,2'-Bipyridine–cyclopentane-1,2,3,4-tetracarboxylic acid (1/1) |
| Formula |
C19 H18 N2 O8 |
| Calculated formula |
C19 H18 N2 O8 |
| SMILES |
c1ccc(nc1)c1ccccn1.OC(=O)[C@@H]1C[C@@H]([C@@H]([C@@H]1C(=O)O)C(=O)O)C(=O)O |
| Title of publication |
2,2'-Bipyridine–cyclopentane-1,2,3,4-tetracarboxylic acid (1/1) |
| Authors of publication |
Lin, Jian-Li; Guo, Xia-Xia; Huang, Wen-Xiang |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
8 |
| Pages of publication |
o1945 |
| a |
12.942 ± 0.003 Å |
| b |
25.118 ± 0.005 Å |
| c |
5.4353 ± 0.0011 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1766.9 ± 0.6 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
62 |
| Hermann-Mauguin space group symbol |
P n m a |
| Hall space group symbol |
-P 2ac 2n |
| Residual factor for all reflections |
0.061 |
| Residual factor for significantly intense reflections |
0.0379 |
| Weighted residual factors for significantly intense reflections |
0.0794 |
| Weighted residual factors for all reflections included in the refinement |
0.0888 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.024 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2231176.html