Information card for entry 2231177
| Chemical name |
9-Phenyl-3,6-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9<i>H</i>- carbazole |
| Formula |
C30 H35 B2 N O4 |
| Calculated formula |
C30 H35 B2 N O4 |
| SMILES |
O1C(C(OB1c1ccc2c(c3c(n2c2ccccc2)ccc(c3)B2OC(C(O2)(C)C)(C)C)c1)(C)C)(C)C |
| Title of publication |
9-Phenyl-3,6-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9<i>H</i>-carbazole |
| Authors of publication |
Wu, Weibing; Tang, Jinan |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
8 |
| Pages of publication |
o1919 |
| a |
13.974 ± 0.006 Å |
| b |
11.935 ± 0.005 Å |
| c |
34.494 ± 0.014 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
5753 ± 4 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.1141 |
| Residual factor for significantly intense reflections |
0.0933 |
| Weighted residual factors for significantly intense reflections |
0.2256 |
| Weighted residual factors for all reflections included in the refinement |
0.2416 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.155 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2231177.html