Information card for entry 2232761
| Chemical name |
(1<i>R</i>,3<i>S</i>)-<i>N</i>-Benzhydryl-2-benzyl-6,7-dimethoxy-1-phenyl- 1,2,3,4-tetrahydroisoquinoline-3-carbothioamide |
| Formula |
C38 H36 N2 O2 S |
| Calculated formula |
C38 H36 N2 O2 S |
| SMILES |
S=C(NC(c1ccccc1)c1ccccc1)[C@H]1N([C@@H](c2cc(OC)c(OC)cc2C1)c1ccccc1)Cc1ccccc1 |
| Title of publication |
(1<i>R</i>,3<i>S</i>)-<i>N</i>-Benzhydryl-2-benzyl-6,7-dimethoxy-1-phenyl-1,2,3,4-tetrahydroisoquinoline-3-carbothioamide |
| Authors of publication |
Naicker, Tricia; Govender, Thavendran; Kruger, Hendrick. G.; Maguire, Glenn E. M. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
12 |
| Pages of publication |
o3441 |
| a |
9.0463 ± 0.0001 Å |
| b |
17.6687 ± 0.0002 Å |
| c |
19.6178 ± 0.0002 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
3135.64 ± 0.06 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.04 |
| Residual factor for significantly intense reflections |
0.0331 |
| Weighted residual factors for significantly intense reflections |
0.0873 |
| Weighted residual factors for all reflections included in the refinement |
0.09 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.064 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2232761.html