Information card for entry 2232803
| Chemical name |
2-[4-(2-Hydroxyethoxy)phenyl]-4,4,5,5-tetramethyl-2-imidazoline-1-oxyl 3-oxide |
| Formula |
C15 H21 N2 O4 |
| Calculated formula |
C15 H21 N2 O4 |
| SMILES |
C1(C(C)(C)N(=C(c2ccc(cc2)OCCO)[N]1=O)=O)(C)C |
| Title of publication |
2-[4-(2-Hydroxyethoxy)phenyl]-4,4,5,5-tetramethyl-2-imidazoline-1-oxyl 3-oxide |
| Authors of publication |
Jing, Lin-Lin; Ma, Hui-Ping; Fan, Xiao-Fei; He, Lei; Jia, Zheng-Ping |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
12 |
| Pages of publication |
o3348 |
| a |
8.869 ± 0.003 Å |
| b |
16.05 ± 0.005 Å |
| c |
20.925 ± 0.006 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2978.6 ± 1.6 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.074 |
| Residual factor for significantly intense reflections |
0.0472 |
| Weighted residual factors for significantly intense reflections |
0.1357 |
| Weighted residual factors for all reflections included in the refinement |
0.1633 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.954 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2232803.html