Information card for entry 2232804
| Chemical name |
1,5-Bis(thiophen-2-yl)-3-(2,4,5-trimethoxyphenyl)pentane-1,5-dione |
| Formula |
C22 H22 O5 S2 |
| Calculated formula |
C22 H22 O5 S2 |
| SMILES |
s1cccc1C(=O)CC(CC(=O)c1sccc1)c1c(OC)cc(OC)c(OC)c1 |
| Title of publication |
1,5-Bis(thiophen-2-yl)-3-(2,4,5-trimethoxyphenyl)pentane-1,5-dione |
| Authors of publication |
Fun, Hoong-Kun; Suwunwong, Thitipone; Boonnak, Nawong; Chantrapromma, Suchada |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
12 |
| Pages of publication |
o3416 - o3417 |
| a |
16.1955 ± 0.0002 Å |
| b |
7.5777 ± 0.0001 Å |
| c |
16.7706 ± 0.0002 Å |
| α |
90° |
| β |
93.49 ± 0.001° |
| γ |
90° |
| Cell volume |
2054.35 ± 0.04 Å3 |
| Cell temperature |
100 K |
| Ambient diffraction temperature |
100 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0483 |
| Residual factor for significantly intense reflections |
0.0378 |
| Weighted residual factors for significantly intense reflections |
0.0953 |
| Weighted residual factors for all reflections included in the refinement |
0.1019 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.041 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2232804.html