Information card for entry 2236231
| Chemical name |
3-(4-Chlorophenyl)-5-phenyl-4,5-dihydro-1,3-oxazole |
| Formula |
C15 H12 Cl N O |
| Calculated formula |
C15 H12 Cl N O |
| SMILES |
Clc1ccc(C2=NOC(C2)c2ccccc2)cc1 |
| Title of publication |
3-(4-Chlorophenyl)-5-phenyl-4,5-dihydro-1,3-oxazole |
| Authors of publication |
Islor, Arun M.; Yaradoni, Rajiv; Garudachari, B.; Gerber, Thomas; Hosten, Eric; Betz, Richard |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
11 |
| Pages of publication |
o3215 |
| a |
29.797 ± 0.005 Å |
| b |
10.717 ± 0.005 Å |
| c |
8.086 ± 0.005 Å |
| α |
90° |
| β |
103.088 ± 0.005° |
| γ |
90° |
| Cell volume |
2515 ± 2 Å3 |
| Cell temperature |
200 ± 2 K |
| Ambient diffraction temperature |
200 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0455 |
| Residual factor for significantly intense reflections |
0.037 |
| Weighted residual factors for significantly intense reflections |
0.0951 |
| Weighted residual factors for all reflections included in the refinement |
0.1029 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.027 |
| Diffraction radiation wavelength |
0.71069 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2236231.html