Information card for entry 2243069
| Chemical name |
2-Methyl-1,1,3,3-tetraphenyl-2-silapropan-2-ol |
| Formula |
C27 H26 O Si |
| Calculated formula |
C27 H26 O Si |
| SMILES |
[Si](O)(C)(C(c1ccccc1)c1ccccc1)C(c1ccccc1)c1ccccc1 |
| Title of publication |
Syntheses and crystal structures of 2-methyl-1,1,2,3,3-pentaphenyl-2-silapropane and 2-methyl-1,1,3,3-tetraphenyl-2-silapropan-2-ol |
| Authors of publication |
Williams, Alexandra; Brown, Michelle; Staples, Richard J.; Biros, Shannon M.; Winchester, William R. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2019 |
| Journal volume |
75 |
| Journal issue |
9 |
| Pages of publication |
1339 - 1343 |
| a |
11.8576 ± 0.0005 Å |
| b |
13.2995 ± 0.0006 Å |
| c |
14.3948 ± 0.0006 Å |
| α |
90° |
| β |
110.363 ± 0.003° |
| γ |
90° |
| Cell volume |
2128.2 ± 0.16 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1175 |
| Residual factor for significantly intense reflections |
0.0616 |
| Weighted residual factors for significantly intense reflections |
0.1417 |
| Weighted residual factors for all reflections included in the refinement |
0.1705 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.973 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2243069.html