Information card for entry 4038871
| Formula |
C42 H58 B2 F8 N2 Ni P4 |
| Calculated formula |
C42 H58 B2 F8 N2 Ni P4 |
| SMILES |
[Ni]123[P@@]4(CN(C[P@@]3(CCCC[P@@]2(CN(C[P@]1(CCCC4)c1ccccc1)CCC)c1ccccc1)c1ccccc1)CCC)c1ccccc1.[B](F)(F)(F)[F-].[B](F)(F)(F)[F-] |
| Title of publication |
Dynamic covalent chemistry approach toward 18-membered P<sub>4</sub>N<sub>2</sub> macrocycles and their nickel(II) complexes. |
| Authors of publication |
Musina, Elvira I.; Wittmann, Tatiana I.; Musin, Lenar; Balueva, Anna S.; Shpagina, Alena S.; Litvinov, Igor A.; Lönnecke, Peter; Hey-Hawkins, Evamarie; Karasik, Andrey A.; Sinyashin, Oleg G. |
| Journal of publication |
The Journal of organic chemistry |
| Year of publication |
2020 |
| a |
13.1558 ± 0.0002 Å |
| b |
21.3869 ± 0.0003 Å |
| c |
16.3943 ± 0.0003 Å |
| α |
90° |
| β |
108.413 ± 0.002° |
| γ |
90° |
| Cell volume |
4376.58 ± 0.13 Å3 |
| Cell temperature |
130 ± 2 K |
| Ambient diffraction temperature |
130 ± 2 K |
| Number of distinct elements |
7 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0737 |
| Residual factor for significantly intense reflections |
0.0449 |
| Weighted residual factors for significantly intense reflections |
0.0906 |
| Weighted residual factors for all reflections included in the refinement |
0.1017 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.028 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4038871.html