Information card for entry 7028988
| Chemical name |
7-(prop-2-in-1-yloxy)-1-benzopyran-2-one |
| Formula |
C12 H8 O3 |
| Calculated formula |
C12 H8 O3 |
| SMILES |
o1c(=O)ccc2ccc(OCC#C)cc12 |
| Title of publication |
Luminescent alkynyl-gold(i) coumarin derivatives and their biological activity. |
| Authors of publication |
Arcau, Julià; Andermark, Vincent; Aguiló, Elisabet; Gandioso, Albert; Moro, Artur; Cetina, Mario; Lima, João Carlos; Rissanen, Kari; Ott, Ingo; Rodríguez, Laura |
| Journal of publication |
Dalton transactions (Cambridge, England : 2003) |
| Year of publication |
2014 |
| Journal volume |
43 |
| Journal issue |
11 |
| Pages of publication |
4426 - 4436 |
| a |
7.0432 ± 0.0002 Å |
| b |
6.4967 ± 0.0003 Å |
| c |
20.6568 ± 0.0006 Å |
| α |
90° |
| β |
91.044 ± 0.003° |
| γ |
90° |
| Cell volume |
945.05 ± 0.06 Å3 |
| Cell temperature |
170 ± 0.1 K |
| Ambient diffraction temperature |
170 ± 0.1 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0524 |
| Residual factor for significantly intense reflections |
0.0415 |
| Weighted residual factors for significantly intense reflections |
0.1252 |
| Weighted residual factors for all reflections included in the refinement |
0.1347 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.041 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7028988.html