Information card for entry 7031388
| Formula |
C40 H56 N6 Ni3 O10 |
| Calculated formula |
C40 H56 N6 Ni3 O10 |
| SMILES |
c12ccccc1C=[N]1CC[N]3(CCCCC3)[Ni]3451[O]2[Ni]12([O]3C(=[O]4)C)([O]=C(C)O[Ni]346([N](=Cc7c(cccc7)[O]14)CC[N]13CCCCC1)[O]2C(=[O]6)C)OC(=[O]5)C.N#CC.N#CC |
| Title of publication |
Syntheses, crystal structures and magnetic properties of a series of μ-phenoxo-μ1,1-carboxylato-μ1,3-carboxylato trinickel(ii) compounds. |
| Authors of publication |
Bhattacharya, Sagarika; Sasmal, Sujit; Carrella, Luca; Rentschler, Eva; Mohanta, Sasankasekhar |
| Journal of publication |
Dalton transactions (Cambridge, England : 2003) |
| Year of publication |
2014 |
| Journal volume |
43 |
| Journal issue |
31 |
| Pages of publication |
12065 - 12076 |
| a |
9.2422 ± 0.0016 Å |
| b |
11.427 ± 0.002 Å |
| c |
11.94 ± 0.002 Å |
| α |
71.389 ± 0.007° |
| β |
86.472 ± 0.007° |
| γ |
68.48 ± 0.006° |
| Cell volume |
1109.5 ± 0.3 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0795 |
| Residual factor for significantly intense reflections |
0.0387 |
| Weighted residual factors for significantly intense reflections |
0.1098 |
| Weighted residual factors for all reflections included in the refinement |
0.1337 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.833 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7031388.html
