Information card for entry 7031389
| Formula |
C40 H58 N4 Ni3 O10 |
| Calculated formula |
C40 H58 N4 Ni3 O10 |
| SMILES |
[O]12[Ni]345([O]6c7ccccc7C=[N]7CC[N]8(CCCCC8)[Ni]867([O]3C(=[O]8)CC)[O]=C(O5)CC)[O]3c5ccccc5C=[N]5CC[N]6(CCCCC6)[Ni]235([O]=C1CC)OC(=[O]4)CC |
| Title of publication |
Syntheses, crystal structures and magnetic properties of a series of μ-phenoxo-μ1,1-carboxylato-μ1,3-carboxylato trinickel(ii) compounds. |
| Authors of publication |
Bhattacharya, Sagarika; Sasmal, Sujit; Carrella, Luca; Rentschler, Eva; Mohanta, Sasankasekhar |
| Journal of publication |
Dalton transactions (Cambridge, England : 2003) |
| Year of publication |
2014 |
| Journal volume |
43 |
| Journal issue |
31 |
| Pages of publication |
12065 - 12076 |
| a |
9.721 ± 0.002 Å |
| b |
18.581 ± 0.004 Å |
| c |
12.238 ± 0.003 Å |
| α |
90° |
| β |
104.402 ± 0.008° |
| γ |
90° |
| Cell volume |
2141 ± 0.8 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0399 |
| Residual factor for significantly intense reflections |
0.03 |
| Weighted residual factors for significantly intense reflections |
0.1045 |
| Weighted residual factors for all reflections included in the refinement |
0.1186 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.949 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7031389.html