Information card for entry 7217019
| Formula |
C18 H19 N O3 |
| Calculated formula |
C18 H19 N O3 |
| SMILES |
O(c1ccc(C(=N\O)\C=C\c2ccc(OC)cc2)cc1)CC |
| Title of publication |
Synthesis, Biological Evaluation, and Molecular Docking Studies of Novel Chalcone Oxime Derivatives as Potential Tubulin Polymerization Inhibitors |
| Authors of publication |
Zhu, Hai-Liang; Qi, Jin-Liang; Jiang, Aiqin; Wang, YanTing; Qin, Yajuan; Zhang, YaLiang; Li, YuJing; Rao, Bing; Zhang, YanQing; Yang, MengRu |
| Journal of publication |
RSC Advances |
| Year of publication |
2014 |
| a |
10.2117 ± 0.0011 Å |
| b |
12.3644 ± 0.0011 Å |
| c |
12.8781 ± 0.0011 Å |
| α |
93.1 ± 0.003° |
| β |
96.848 ± 0.003° |
| γ |
90.294 ± 0.003° |
| Cell volume |
1611.9 ± 0.3 Å3 |
| Cell temperature |
273 ± 2 K |
| Ambient diffraction temperature |
273 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.121 |
| Residual factor for significantly intense reflections |
0.0557 |
| Weighted residual factors for significantly intense reflections |
0.1263 |
| Weighted residual factors for all reflections included in the refinement |
0.1526 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.008 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7217019.html
