Information card for entry 7217020
| Formula |
C18 H19 N O3 |
| Calculated formula |
C18 H19 N O3 |
| SMILES |
O(c1ccc(C(=N\O)/C=C/c2c(OC)cccc2)cc1)CC |
| Title of publication |
Synthesis, Biological Evaluation, and Molecular Docking Studies of Novel Chalcone Oxime Derivatives as Potential Tubulin Polymerization Inhibitors |
| Authors of publication |
Zhu, Hai-Liang; Qi, Jin-Liang; Jiang, Aiqin; Wang, YanTing; Qin, Yajuan; Zhang, YaLiang; Li, YuJing; Rao, Bing; Zhang, YanQing; Yang, MengRu |
| Journal of publication |
RSC Advances |
| Year of publication |
2014 |
| a |
5.8593 ± 0.0008 Å |
| b |
9.5104 ± 0.0012 Å |
| c |
14.924 ± 0.002 Å |
| α |
71.852 ± 0.004° |
| β |
81.981 ± 0.004° |
| γ |
89.066 ± 0.004° |
| Cell volume |
782.21 ± 0.18 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.1838 |
| Residual factor for significantly intense reflections |
0.1588 |
| Weighted residual factors for significantly intense reflections |
0.4646 |
| Weighted residual factors for all reflections included in the refinement |
0.4894 |
| Goodness-of-fit parameter for all reflections included in the refinement |
2.07 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7217020.html
