Information card for entry 1548890
| Chemical name |
2-Amino-4-(4-methoxyphenyl)-1-(4-methylphenyl)-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carbonitrile |
| Formula |
C24 H23 N3 O2 |
| Calculated formula |
C24 H23 N3 O2 |
| SMILES |
O=C1C2=C(N(C(=C(C2c2ccc(OC)cc2)C#N)N)c2ccc(cc2)C)CCC1 |
| Title of publication |
2-Amino-4-(4-methoxyphenyl)-1-(4-methylphenyl)-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carbonitrile |
| Authors of publication |
Tamam, Asmaa H. A.; Kaur, Manpreet; Akkurt, Mehmet; Mohamed, Shaaban K.; Jasinski, Jerry P.; Hussain, Faiq H. S. |
| Journal of publication |
IUCrData |
| Year of publication |
2018 |
| Journal volume |
3 |
| Journal issue |
2 |
| Pages of publication |
x180167 |
| a |
9.1066 ± 0.0004 Å |
| b |
19.6406 ± 0.0009 Å |
| c |
11.2901 ± 0.0005 Å |
| α |
90° |
| β |
94.343 ± 0.004° |
| γ |
90° |
| Cell volume |
2013.54 ± 0.16 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0682 |
| Residual factor for significantly intense reflections |
0.0505 |
| Weighted residual factors for significantly intense reflections |
0.137 |
| Weighted residual factors for all reflections included in the refinement |
0.149 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.052 |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1548890.html