Information card for entry 1548891
| Common name |
(N<i>Z</i>)-<i>N</i>-[(1,3-Diphenyl-1<i>H</i>-pyrazol-4-yl)methylidene]- <i>N</i>- oxidoanilinium |
| Chemical name |
(<i>Z</i>)-1-(1,3-Diphenyl-1<i>H</i>-pyrazol-4-yl)-<i>N</i>-phenylmethanimine <i>N</i>-oxide |
| Formula |
C22 H17 N3 O |
| Calculated formula |
C22 H17 N3 O |
| SMILES |
O=N(=Cc1c(nn(c1)c1ccccc1)c1ccccc1)c1ccccc1 |
| Title of publication |
(<i>Z</i>)-1-(1,3-Diphenyl-1<i>H</i>-pyrazol-4-yl)-<i>N</i>-phenylmethanimine <i>N</i>-oxide |
| Authors of publication |
Mohamed, Shaaban K.; Mague, Joel T.; Akkurt, Mehmet; Said, Awad I.; Hawaiz, Farouq E.; Elgarhy, Sahar M. I. |
| Journal of publication |
IUCrData |
| Year of publication |
2018 |
| Journal volume |
3 |
| Journal issue |
2 |
| Pages of publication |
x180208 |
| a |
9.1084 ± 0.0008 Å |
| b |
10.8314 ± 0.0009 Å |
| c |
17.2226 ± 0.0014 Å |
| α |
90° |
| β |
94.06 ± 0.003° |
| γ |
90° |
| Cell volume |
1694.9 ± 0.2 Å3 |
| Cell temperature |
150 ± 2 K |
| Ambient diffraction temperature |
150 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0372 |
| Residual factor for significantly intense reflections |
0.0346 |
| Weighted residual factors for significantly intense reflections |
0.0844 |
| Weighted residual factors for all reflections included in the refinement |
0.0864 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.055 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1548891.html