Information card for entry 2001948
| Formula |
C10 H6 O8 |
| Calculated formula |
C10 H6 O8 |
| SMILES |
OC(=O)c1c(ccc(c1C(=O)O)C(=O)O)C(=O)O |
| Title of publication |
Structures of 1,2,3,4-benzenetetracarboxylic acid and 1,2,3,5-benzenetetracarboxylic acid dihydrate |
| Authors of publication |
Barrio, C.; García-Granda, S.; Gómez-Beltrán, F. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1993 |
| Journal volume |
49 |
| Journal issue |
2 |
| Pages of publication |
253 - 257 |
| a |
9.5616 ± 0.0001 Å |
| b |
8.4696 ± 0.0001 Å |
| c |
7.0568 ± 0.0001 Å |
| α |
106.806 ± 0.001° |
| β |
100.192 ± 0.001° |
| γ |
69.557 ± 0.001° |
| Cell volume |
510.776 ± 0.012 Å3 |
| Number of distinct elements |
3 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2001948.html
