Information card for entry 2001949
| Formula |
C10 H10 O10 |
| Calculated formula |
C10 H10 O10 |
| SMILES |
OC(=O)c1cc(cc(c1C(=O)O)C(=O)O)C(=O)O.O.O |
| Title of publication |
Structures of 1,2,3,4-benzenetetracarboxylic acid and 1,2,3,5-benzenetetracarboxylic acid dihydrate |
| Authors of publication |
Barrio, C.; García-Granda, S.; Gómez-Beltrán, F. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1993 |
| Journal volume |
49 |
| Journal issue |
2 |
| Pages of publication |
253 - 257 |
| a |
5.845 ± 0.004 Å |
| b |
7.828 ± 0.006 Å |
| c |
13.31 ± 0.01 Å |
| α |
94.8 ± 0.1° |
| β |
100.6 ± 0.1° |
| γ |
93.63 ± 0.09° |
| Cell volume |
594.6 ± 0.8 Å3 |
| Number of distinct elements |
3 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2001949.html